C14H23NO — CID 162755703
1-methylcyclohexa-1,3-diene;1-pyrrolidin-3-ylpropan-1-one (PubChem CID 162755703) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-methylcyclohexa-1,3-diene;1-pyrrolidin-3-ylpropan-1-one.
| Compound Name | 1-methylcyclohexa-1,3-diene;1-pyrrolidin-3-ylpropan-1-one |
|---|---|
| PubChem CID | 162755703 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-methylcyclohexa-1,3-diene;1-pyrrolidin-3-ylpropan-1-one |
| SMILES | CC1=CC=CCC1.CCC(=O)C1CCNC1 |
| InChI | InChI=1S/C7H13NO.C7H10/c1-2-7(9)6-3-4-8-5-6;1-7-5-3-2-4-6-7/h6,8H,2-5H2,1H3;2-3,5H,4,6H2,1H3 |
| InChIKey | FIKFFBKEHDIBOZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |