C37H36N2 — CID 143792520
7-cyclohexyl-13,18,18-trimethyl-2,3-diphenyl-2,17-diazapentacyclo[13.2.1.04,17.05,10.011,16]octadeca-3,5(10),6,8,11(16),12,14-heptaene (PubChem CID 143792520) has the molecular formula C37H36N2 and a molecular weight of 508.71 g/mol. Its IUPAC name is 7-cyclohexyl-13,18,18-trimethyl-2,3-diphenyl-2,17-diazapentacyclo[13.2.1.04,17.05,10.011,16]octadeca-3,5(10),6,8,11(16),12,14-heptaene.
| Compound Name | 7-cyclohexyl-13,18,18-trimethyl-2,3-diphenyl-2,17-diazapentacyclo[13.2.1.04,17.05,10.011,16]octadeca-3,5(10),6,8,11(16),12,14-heptaene |
|---|---|
| PubChem CID | 143792520 |
| Molecular Formula | C37H36N2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | 7-cyclohexyl-13,18,18-trimethyl-2,3-diphenyl-2,17-diazapentacyclo[13.2.1.04,17.05,10.011,16]octadeca-3,5(10),6,8,11(16),12,14-heptaene |
| SMILES | Cc1cc2c3c(c1)C(C)(C)C1N(c4ccccc4)C(c4ccccc4)=C(c4cc(C5CCCCC5)ccc4-2)N31 |
| InChI | InChI=1S/C37H36N2/c1-24-21-30-29-20-19-27(25-13-7-4-8-14-25)23-31(29)35-33(26-15-9-5-10-16-26)38(28-17-11-6-12-18-28)36-37(2,3)32(22-24)34(30)39(35)36/h5-6,9-12,15-23,25,36H,4,7-8,13-14H2,1-3H3 |
| InChIKey | OWCAAIYYEVRBGH-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|