C22H36O2 — CID 14379328
(1S,4E,6Z,10E)-8-ethoxy-4,10-dimethyl-14-methylidene-7-propan-2-ylcyclotetradeca-4,6,10-trien-1-ol (PubChem CID 14379328) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (1S,4E,6Z,10E)-8-ethoxy-4,10-dimethyl-14-methylidene-7-propan-2-ylcyclotetradeca-4,6,10-trien-1-ol.
| Compound Name | (1S,4E,6Z,10E)-8-ethoxy-4,10-dimethyl-14-methylidene-7-propan-2-ylcyclotetradeca-4,6,10-trien-1-ol |
|---|---|
| PubChem CID | 14379328 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (1S,4E,6Z,10E)-8-ethoxy-4,10-dimethyl-14-methylidene-7-propan-2-ylcyclotetradeca-4,6,10-trien-1-ol |
| SMILES | C=C1CC/C=C(\C)CC(OCC)/C(C(C)C)=C\C=C(/C)CC[C@@H]1O |
| InChI | InChI=1S/C22H36O2/c1-7-24-22-15-18(5)9-8-10-19(6)21(23)14-12-17(4)11-13-20(22)16(2)3/h9,11,13,16,21-23H,6-8,10,12,14-15H2,1-5H3/b17-11+,18-9+,20-13-/t21-,22?/m0/s1 |
| InChIKey | GRURPUQKXZLJEX-ZDQQRVLJSA-N |
| XLogP | 5.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|