amino (4-methylphenyl) hydrogen phosphite

C7H10NO3P — CID 143793630

IUPACamino (4-methylphenyl) hydrogen phosphite
SMILESCc1ccc(OP(O)ON)cc1
InChIInChI=1S/C7H10NO3P/c1-6-2-4-7(5-3-6)10-12(9)11-8/h2-5,9H,8H2,1H3
InChIKeyLKJOFRCHIRJYDG-UHFFFAOYSA-N
MW187.14 g/mol
LogP1.48
Rot. Bonds3

About amino (4-methylphenyl) hydrogen phosphite

amino (4-methylphenyl) hydrogen phosphite (PubChem CID 143793630) has the molecular formula C7H10NO3P and a molecular weight of 187.14 g/mol. Its IUPAC name is amino (4-methylphenyl) hydrogen phosphite.

Molecular Properties

Compound Nameamino (4-methylphenyl) hydrogen phosphite
PubChem CID143793630
Molecular FormulaC7H10NO3P
Molecular Weight187.14 g/mol
Exact Mass187.04
IUPAC Nameamino (4-methylphenyl) hydrogen phosphite
SMILESCc1ccc(OP(O)ON)cc1
InChIInChI=1S/C7H10NO3P/c1-6-2-4-7(5-3-6)10-12(9)11-8/h2-5,9H,8H2,1H3
InChIKeyLKJOFRCHIRJYDG-UHFFFAOYSA-N
XLogP1.48
TPSA64.71 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.14
LogP ≤ 51.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze amino (4-methylphenyl) hydrogen phosphite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

phosphane;tris(4-methylphenyl) phosphite
CID 174494653
3-hydroxypropyl (4-methylphenyl) hydrogen phosphite
CID 57282187
formaldehyde;ruthenium(4+);bis(tris(4-methylphenyl) phosphite);tetrachloride
CID 23462594
bis(4-methylphenyl) propan-2-yl phosphite
CID 155662837
phenylphosphane;tris(4-methylphenyl) phosphite
CID 174790413
(4-methylphenoxy)methyl dihydrogen phosphite
CID 143072711
1-(113C)methoxy-4-methylbenzene
CID 166176950
1-methyl-4-(4-methylphenoxy)benzene;dihydrofluoride
CID 174481204
O-[1-(4-methylphenoxy)ethenoxy]hydroxylamine
CID 59010874
ethoxy-ethyl-(4-methylphenoxy)phosphane
CID 57278205
[4-[(4-dihydroxyphosphanyloxyphenyl)-(4-methylphenyl)phosphanyl]phenoxy]-hydroxy-oxophosphanium
CID 89031152
diphenyl hydrogen phosphite;ethanol
CID 159674253

Frequently Asked Questions

What is the IUPAC name of amino (4-methylphenyl) hydrogen phosphite?
The IUPAC name of amino (4-methylphenyl) hydrogen phosphite (CID 143793630) is amino (4-methylphenyl) hydrogen phosphite.
What is the SMILES notation for amino (4-methylphenyl) hydrogen phosphite?
The canonical SMILES for amino (4-methylphenyl) hydrogen phosphite is Cc1ccc(OP(O)ON)cc1.
What is the InChIKey of amino (4-methylphenyl) hydrogen phosphite?
The InChIKey is LKJOFRCHIRJYDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10NO3P/c1-6-2-4-7(5-3-6)10-12(9)11-8/h2-5,9H,8H2,1H3.
What are the key properties of amino (4-methylphenyl) hydrogen phosphite?
amino (4-methylphenyl) hydrogen phosphite has a molecular weight of 187.14 g/mol, XLogP of 1.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino (4-methylphenyl) hydrogen phosphite is sourced from PubChem (CID 143793630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).