About 3-hydroxypropyl (4-methylphenyl) hydrogen phosphite
3-hydroxypropyl (4-methylphenyl) hydrogen phosphite (PubChem CID 57282187) has the molecular formula C10H15O4P
and a molecular weight of 230.20 g/mol. Its IUPAC name is 3-hydroxypropyl (4-methylphenyl) hydrogen phosphite.
Molecular Properties
| Compound Name | 3-hydroxypropyl (4-methylphenyl) hydrogen phosphite |
| PubChem CID | 57282187 |
| Molecular Formula | C10H15O4P |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 3-hydroxypropyl (4-methylphenyl) hydrogen phosphite |
| SMILES | Cc1ccc(OP(O)OCCCO)cc1 |
| InChI | InChI=1S/C10H15O4P/c1-9-3-5-10(6-4-9)14-15(12)13-8-2-7-11/h3-6,11-12H,2,7-8H2,1H3 |
| InChIKey | CBPBPRYMFURRHY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropyl (4-methylphenyl) hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropyl (4-methylphenyl) hydrogen phosphite?
The IUPAC name of 3-hydroxypropyl (4-methylphenyl) hydrogen phosphite (CID 57282187) is 3-hydroxypropyl (4-methylphenyl) hydrogen phosphite.
What is the SMILES notation for 3-hydroxypropyl (4-methylphenyl) hydrogen phosphite?
The canonical SMILES for 3-hydroxypropyl (4-methylphenyl) hydrogen phosphite is Cc1ccc(OP(O)OCCCO)cc1.
What is the InChIKey of 3-hydroxypropyl (4-methylphenyl) hydrogen phosphite?
The InChIKey is CBPBPRYMFURRHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15O4P/c1-9-3-5-10(6-4-9)14-15(12)13-8-2-7-11/h3-6,11-12H,2,7-8H2,1H3.
What are the key properties of 3-hydroxypropyl (4-methylphenyl) hydrogen phosphite?
3-hydroxypropyl (4-methylphenyl) hydrogen phosphite has a molecular weight of 230.20 g/mol, XLogP of 1.99, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropyl (4-methylphenyl) hydrogen phosphite is sourced from PubChem (CID 57282187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).