C17H17N5O2Se — CID 143794129
5-[5-[4-[amino-(hydroxyamino)methyl]phenyl]selenophen-2-yl]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 143794129) has the molecular formula C17H17N5O2Se and a molecular weight of 402.32 g/mol. Its IUPAC name is 5-[5-[4-[amino-(hydroxyamino)methyl]phenyl]selenophen-2-yl]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 5-[5-[4-[amino-(hydroxyamino)methyl]phenyl]selenophen-2-yl]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 143794129 |
| Molecular Formula | C17H17N5O2Se |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 5-[5-[4-[amino-(hydroxyamino)methyl]phenyl]selenophen-2-yl]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | N/C(=N\O)c1ccc(-c2ccc(-c3ccc(C(N)NO)cc3)[se]2)cn1 |
| InChI | InChI=1S/C17H17N5O2Se/c18-16(21-23)11-3-1-10(2-4-11)14-7-8-15(25-14)12-5-6-13(20-9-12)17(19)22-24/h1-9,16,21,23-24H,18H2,(H2,19,22) |
| InChIKey | FZXAGLNQNVHMKI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|