C28H30N4O2 — CID 143794395
2-(4-aminophenyl)-2-[[2-(1H-indol-3-yl)acetyl]-methylamino]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 143794395) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-(4-aminophenyl)-2-[[2-(1H-indol-3-yl)acetyl]-methylamino]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-(4-aminophenyl)-2-[[2-(1H-indol-3-yl)acetyl]-methylamino]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 143794395 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 2-(4-aminophenyl)-2-[[2-(1H-indol-3-yl)acetyl]-methylamino]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)C(c2ccc(N)cc2)N(C)C(=O)Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H30N4O2/c1-18(2)19-10-14-23(15-11-19)31-28(34)27(20-8-12-22(29)13-9-20)32(3)26(33)16-21-17-30-25-7-5-4-6-24(21)25/h4-15,17-18,27,30H,16,29H2,1-3H3,(H,31,34) |
| InChIKey | LBEMYJFAPNNMOJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|