C29H30N2O2 — CID 167547683
2-[[2-(3H-inden-1-yl)acetyl]-methylamino]-2-phenyl-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 167547683) has the molecular formula C29H30N2O2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-[[2-(3H-inden-1-yl)acetyl]-methylamino]-2-phenyl-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[[2-(3H-inden-1-yl)acetyl]-methylamino]-2-phenyl-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 167547683 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-[[2-(3H-inden-1-yl)acetyl]-methylamino]-2-phenyl-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)C(c2ccccc2)N(C)C(=O)CC2=CCc3ccccc32)cc1 |
| InChI | InChI=1S/C29H30N2O2/c1-20(2)21-15-17-25(18-16-21)30-29(33)28(23-10-5-4-6-11-23)31(3)27(32)19-24-14-13-22-9-7-8-12-26(22)24/h4-12,14-18,20,28H,13,19H2,1-3H3,(H,30,33) |
| InChIKey | BZRKNGSFHOQIAF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |