C18H12F4N2O2S — CID 143794992
1-[5-(2,5-difluorophenyl)-6',8'-difluorospiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone (PubChem CID 143794992) has the molecular formula C18H12F4N2O2S and a molecular weight of 396.37 g/mol. Its IUPAC name is 1-[5-(2,5-difluorophenyl)-6',8'-difluorospiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone.
| Compound Name | 1-[5-(2,5-difluorophenyl)-6',8'-difluorospiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone |
|---|---|
| PubChem CID | 143794992 |
| Molecular Formula | C18H12F4N2O2S |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 1-[5-(2,5-difluorophenyl)-6',8'-difluorospiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2cc(F)ccc2F)SC12CCOc1c(F)cc(F)cc12 |
| InChI | InChI=1S/C18H12F4N2O2S/c1-9(25)24-18(4-5-26-16-13(18)7-11(20)8-15(16)22)27-17(23-24)12-6-10(19)2-3-14(12)21/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | JPBAOPVMOFLIHE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |