C18H14F2N2O3S2 — CID 58274715
1-[5-(2,5-difluorophenyl)-1',1'-dioxospiro[1,3,4-thiadiazole-2,4'-2,3-dihydrothiochromene]-3-yl]ethanone (PubChem CID 58274715) has the molecular formula C18H14F2N2O3S2 and a molecular weight of 408.45 g/mol. Its IUPAC name is 1-[5-(2,5-difluorophenyl)-1',1'-dioxospiro[1,3,4-thiadiazole-2,4'-2,3-dihydrothiochromene]-3-yl]ethanone.
| Compound Name | 1-[5-(2,5-difluorophenyl)-1',1'-dioxospiro[1,3,4-thiadiazole-2,4'-2,3-dihydrothiochromene]-3-yl]ethanone |
|---|---|
| PubChem CID | 58274715 |
| Molecular Formula | C18H14F2N2O3S2 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 1-[5-(2,5-difluorophenyl)-1',1'-dioxospiro[1,3,4-thiadiazole-2,4'-2,3-dihydrothiochromene]-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2cc(F)ccc2F)SC12CCS(=O)(=O)c1ccccc12 |
| InChI | InChI=1S/C18H14F2N2O3S2/c1-11(23)22-18(8-9-27(24,25)16-5-3-2-4-14(16)18)26-17(21-22)13-10-12(19)6-7-15(13)20/h2-7,10H,8-9H2,1H3 |
| InChIKey | GDAULMXPORNEQP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |