C19H13F5N2OS — CID 58274922
1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]-2,2,2-trifluoroethanone (PubChem CID 58274922) has the molecular formula C19H13F5N2OS and a molecular weight of 412.38 g/mol. Its IUPAC name is 1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 58274922 |
| Molecular Formula | C19H13F5N2OS |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1N=C(c2cc(F)ccc2F)SC12CCCc1ccccc12)C(F)(F)F |
| InChI | InChI=1S/C19H13F5N2OS/c20-12-7-8-15(21)13(10-12)16-25-26(17(27)19(22,23)24)18(28-16)9-3-5-11-4-1-2-6-14(11)18/h1-2,4,6-8,10H,3,5,9H2 |
| InChIKey | ZRWOLBGIEBQQII-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |