C23H23F2N3OS — CID 42633995
[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]-[(2S)-piperidin-2-yl]methanone (PubChem CID 42633995) has the molecular formula C23H23F2N3OS and a molecular weight of 427.52 g/mol. Its IUPAC name is [5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]-[(2S)-piperidin-2-yl]methanone.
| Compound Name | [5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]-[(2S)-piperidin-2-yl]methanone |
|---|---|
| PubChem CID | 42633995 |
| Molecular Formula | C23H23F2N3OS |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | [5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]-[(2S)-piperidin-2-yl]methanone |
| SMILES | O=C([C@@H]1CCCCN1)N1N=C(c2cc(F)ccc2F)SC12CCCc1ccccc12 |
| InChI | InChI=1S/C23H23F2N3OS/c24-16-10-11-19(25)17(14-16)21-27-28(22(29)20-9-3-4-13-26-20)23(30-21)12-5-7-15-6-1-2-8-18(15)23/h1-2,6,8,10-11,14,20,26H,3-5,7,9,12-13H2/t20-,23?/m0/s1 |
| InChIKey | XRXRQTGTIDYPHT-AJZOCDQUSA-N |
| XLogP | 4.53 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |