C20H21F2N3OS2 — CID 143891222
[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-5,6,7,7a-tetrahydro-3aH-1-benzothiophene]-3-yl]-[(2S)-pyrrolidin-2-yl]methanone (PubChem CID 143891222) has the molecular formula C20H21F2N3OS2 and a molecular weight of 421.54 g/mol. Its IUPAC name is [5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-5,6,7,7a-tetrahydro-3aH-1-benzothiophene]-3-yl]-[(2S)-pyrrolidin-2-yl]methanone.
| Compound Name | [5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-5,6,7,7a-tetrahydro-3aH-1-benzothiophene]-3-yl]-[(2S)-pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 143891222 |
| Molecular Formula | C20H21F2N3OS2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | [5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-5,6,7,7a-tetrahydro-3aH-1-benzothiophene]-3-yl]-[(2S)-pyrrolidin-2-yl]methanone |
| SMILES | O=C([C@@H]1CCCN1)N1N=C(c2cc(F)ccc2F)SC12CCCC1SC=CC12 |
| InChI | InChI=1S/C20H21F2N3OS2/c21-12-5-6-15(22)13(11-12)18-24-25(19(26)16-3-2-9-23-16)20(28-18)8-1-4-17-14(20)7-10-27-17/h5-7,10-11,14,16-17,23H,1-4,8-9H2/t14?,16-,17?,20?/m0/s1 |
| InChIKey | YNGLECFGOUWSHQ-JOELBRMTSA-N |
| XLogP | 4.08 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |