C21H18F2N2OS — CID 58274749
cyclopropyl-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]methanone (PubChem CID 58274749) has the molecular formula C21H18F2N2OS and a molecular weight of 384.45 g/mol. Its IUPAC name is cyclopropyl-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]methanone.
| Compound Name | cyclopropyl-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]methanone |
|---|---|
| PubChem CID | 58274749 |
| Molecular Formula | C21H18F2N2OS |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | cyclopropyl-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]methanone |
| SMILES | O=C(C1CC1)N1N=C(c2cc(F)ccc2F)SC12CCCc1ccccc12 |
| InChI | InChI=1S/C21H18F2N2OS/c22-15-9-10-18(23)16(12-15)19-24-25(20(26)14-7-8-14)21(27-19)11-3-5-13-4-1-2-6-17(13)21/h1-2,4,6,9-10,12,14H,3,5,7-8,11H2 |
| InChIKey | OLFWUQNOQPEPRK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |