C24H19F2N3OS — CID 58274622
1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]-2-pyridin-3-ylethanone (PubChem CID 58274622) has the molecular formula C24H19F2N3OS and a molecular weight of 435.50 g/mol. Its IUPAC name is 1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 58274622 |
| Molecular Formula | C24H19F2N3OS |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)N1N=C(c2cc(F)ccc2F)SC12CCCc1ccccc12 |
| InChI | InChI=1S/C24H19F2N3OS/c25-18-9-10-21(26)19(14-18)23-28-29(22(30)13-16-5-4-12-27-15-16)24(31-23)11-3-7-17-6-1-2-8-20(17)24/h1-2,4-6,8-10,12,14-15H,3,7,11,13H2 |
| InChIKey | RWNJAKRAZNNXPF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |