C22H21F2N3O2S — CID 58274825
[(1R,3R)-3-aminocyclopentyl]-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]methanone (PubChem CID 58274825) has the molecular formula C22H21F2N3O2S and a molecular weight of 429.49 g/mol. Its IUPAC name is [(1R,3R)-3-aminocyclopentyl]-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]methanone.
| Compound Name | [(1R,3R)-3-aminocyclopentyl]-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]methanone |
|---|---|
| PubChem CID | 58274825 |
| Molecular Formula | C22H21F2N3O2S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [(1R,3R)-3-aminocyclopentyl]-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]methanone |
| SMILES | N[C@@H]1CC[C@@H](C(=O)N2N=C(c3cc(F)ccc3F)SC23CCOc2ccccc23)C1 |
| InChI | InChI=1S/C22H21F2N3O2S/c23-14-6-8-18(24)16(12-14)20-26-27(21(28)13-5-7-15(25)11-13)22(30-20)9-10-29-19-4-2-1-3-17(19)22/h1-4,6,8,12-13,15H,5,7,9-11,25H2/t13-,15-,22?/m1/s1 |
| InChIKey | ZUVAASLIAKOENR-DJCLOVHTSA-N |
| XLogP | 3.96 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |