C24H25F2N3O2S — CID 58274688
1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-3-piperidin-3-ylpropan-1-one (PubChem CID 58274688) has the molecular formula C24H25F2N3O2S and a molecular weight of 457.55 g/mol. Its IUPAC name is 1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-3-piperidin-3-ylpropan-1-one.
| Compound Name | 1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-3-piperidin-3-ylpropan-1-one |
|---|---|
| PubChem CID | 58274688 |
| Molecular Formula | C24H25F2N3O2S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 1-[5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-3-piperidin-3-ylpropan-1-one |
| SMILES | O=C(CCC1CCCNC1)N1N=C(c2cc(F)ccc2F)SC12CCOc1ccccc12 |
| InChI | InChI=1S/C24H25F2N3O2S/c25-17-8-9-20(26)18(14-17)23-28-29(22(30)10-7-16-4-3-12-27-15-16)24(32-23)11-13-31-21-6-2-1-5-19(21)24/h1-2,5-6,8-9,14,16,27H,3-4,7,10-13,15H2 |
| InChIKey | IRWXNGMOWAHBMC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |