C21H20ClF2N3OS — CID 58274973
1-[(2R,3'R)-3'-(2-aminoethyl)-6'-chloro-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]ethanone (PubChem CID 58274973) has the molecular formula C21H20ClF2N3OS and a molecular weight of 435.93 g/mol. Its IUPAC name is 1-[(2R,3'R)-3'-(2-aminoethyl)-6'-chloro-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]ethanone.
| Compound Name | 1-[(2R,3'R)-3'-(2-aminoethyl)-6'-chloro-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]ethanone |
|---|---|
| PubChem CID | 58274973 |
| Molecular Formula | C21H20ClF2N3OS |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 1-[(2R,3'R)-3'-(2-aminoethyl)-6'-chloro-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2cc(F)ccc2F)S[C@]12c1cc(Cl)ccc1CC[C@@H]2CCN |
| InChI | InChI=1S/C21H20ClF2N3OS/c1-12(28)27-21(29-20(26-27)17-11-16(23)6-7-19(17)24)14(8-9-25)4-2-13-3-5-15(22)10-18(13)21/h3,5-7,10-11,14H,2,4,8-9,25H2,1H3/t14-,21-/m1/s1 |
| InChIKey | MREWUHWHZIKCKT-SPLOXXLWSA-N |
| XLogP | 4.64 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |