C20H20F2N4OS — CID 71019957
1-[(2S,3'S)-3'-(2-aminoethyl)-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone (PubChem CID 71019957) has the molecular formula C20H20F2N4OS and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-[(2S,3'S)-3'-(2-aminoethyl)-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone.
| Compound Name | 1-[(2S,3'S)-3'-(2-aminoethyl)-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone |
|---|---|
| PubChem CID | 71019957 |
| Molecular Formula | C20H20F2N4OS |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1-[(2S,3'S)-3'-(2-aminoethyl)-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2cc(F)ccc2F)S[C@@]12c1ccccc1NC[C@@H]2CCN |
| InChI | InChI=1S/C20H20F2N4OS/c1-12(27)26-20(28-19(25-26)15-10-14(21)6-7-17(15)22)13(8-9-23)11-24-18-5-3-2-4-16(18)20/h2-7,10,13,24H,8-9,11,23H2,1H3/t13-,20-/m0/s1 |
| InChIKey | ZUTYVGRCZQHYFR-RBZFPXEDSA-N |
| XLogP | 3.47 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |