C20H18F4N4O2 — CID 58341229
1-[3'-(2-aminoethyl)-5-(2,5-difluorophenyl)-6',7'-difluorospiro[1,3,4-oxadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone (PubChem CID 58341229) has the molecular formula C20H18F4N4O2 and a molecular weight of 422.38 g/mol. Its IUPAC name is 1-[3'-(2-aminoethyl)-5-(2,5-difluorophenyl)-6',7'-difluorospiro[1,3,4-oxadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone.
| Compound Name | 1-[3'-(2-aminoethyl)-5-(2,5-difluorophenyl)-6',7'-difluorospiro[1,3,4-oxadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone |
|---|---|
| PubChem CID | 58341229 |
| Molecular Formula | C20H18F4N4O2 |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 1-[3'-(2-aminoethyl)-5-(2,5-difluorophenyl)-6',7'-difluorospiro[1,3,4-oxadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2cc(F)ccc2F)OC12c1cc(F)c(F)cc1NCC2CCN |
| InChI | InChI=1S/C20H18F4N4O2/c1-10(29)28-20(30-19(27-28)13-6-12(21)2-3-15(13)22)11(4-5-25)9-26-18-8-17(24)16(23)7-14(18)20/h2-3,6-8,11,26H,4-5,9,25H2,1H3 |
| InChIKey | CNLMKDZKGJPCBX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |