C19H17F2N3O2S — CID 70844953
1-[(2S,3'S)-3'-(aminomethyl)-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone (PubChem CID 70844953) has the molecular formula C19H17F2N3O2S and a molecular weight of 389.43 g/mol. Its IUPAC name is 1-[(2S,3'S)-3'-(aminomethyl)-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone.
| Compound Name | 1-[(2S,3'S)-3'-(aminomethyl)-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone |
|---|---|
| PubChem CID | 70844953 |
| Molecular Formula | C19H17F2N3O2S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 1-[(2S,3'S)-3'-(aminomethyl)-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2cc(F)ccc2F)S[C@@]12c1ccccc1OC[C@@H]2CN |
| InChI | InChI=1S/C19H17F2N3O2S/c1-11(25)24-19(12(9-22)10-26-17-5-3-2-4-15(17)19)27-18(23-24)14-8-13(20)6-7-16(14)21/h2-8,12H,9-10,22H2,1H3/t12-,19-/m0/s1 |
| InChIKey | FNHGGRJGMKDHQP-BUXKBTBVSA-N |
| XLogP | 3.04 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |