C21H19F3N2O2S — CID 143891273
1-[(2S,3'R)-5-(2,4-difluorophenyl)-6'-fluoro-3'-propylspiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone (PubChem CID 143891273) has the molecular formula C21H19F3N2O2S and a molecular weight of 420.46 g/mol. Its IUPAC name is 1-[(2S,3'R)-5-(2,4-difluorophenyl)-6'-fluoro-3'-propylspiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone.
| Compound Name | 1-[(2S,3'R)-5-(2,4-difluorophenyl)-6'-fluoro-3'-propylspiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone |
|---|---|
| PubChem CID | 143891273 |
| Molecular Formula | C21H19F3N2O2S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 1-[(2S,3'R)-5-(2,4-difluorophenyl)-6'-fluoro-3'-propylspiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]ethanone |
| SMILES | CCC[C@@H]1COc2ccc(F)cc2[C@@]12SC(c1ccc(F)cc1F)=NN2C(C)=O |
| InChI | InChI=1S/C21H19F3N2O2S/c1-3-4-13-11-28-19-8-6-14(22)9-17(19)21(13)26(12(2)27)25-20(29-21)16-7-5-15(23)10-18(16)24/h5-10,13H,3-4,11H2,1-2H3/t13-,21+/m1/s1 |
| InChIKey | PRMZAXLDZAGIRJ-ASSNKEHSSA-N |
| XLogP | 5.02 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |