C23H24F2N4O3S — CID 58274875
[(2S,3'R)-3'-(2-aminoethyl)-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-morpholin-4-ylmethanone (PubChem CID 58274875) has the molecular formula C23H24F2N4O3S and a molecular weight of 474.53 g/mol. Its IUPAC name is [(2S,3'R)-3'-(2-aminoethyl)-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [(2S,3'R)-3'-(2-aminoethyl)-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 58274875 |
| Molecular Formula | C23H24F2N4O3S |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | [(2S,3'R)-3'-(2-aminoethyl)-5-(2,5-difluorophenyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-morpholin-4-ylmethanone |
| SMILES | NCC[C@@H]1COc2ccccc2[C@@]12SC(c1cc(F)ccc1F)=NN2C(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H24F2N4O3S/c24-16-5-6-19(25)17(13-16)21-27-29(22(30)28-9-11-31-12-10-28)23(33-21)15(7-8-26)14-32-20-4-2-1-3-18(20)23/h1-6,13,15H,7-12,14,26H2/t15-,23+/m1/s1 |
| InChIKey | URSROTYOSUHPSB-CMJOXMDJSA-N |
| XLogP | 3.34 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |