C22H20F3N3O5S — CID 58274840
(2S)-1-[5-(2,5-difluorophenyl)-6'-fluoro-3'-(2-nitroethyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-2-methoxypropan-1-one (PubChem CID 58274840) has the molecular formula C22H20F3N3O5S and a molecular weight of 495.48 g/mol. Its IUPAC name is (2S)-1-[5-(2,5-difluorophenyl)-6'-fluoro-3'-(2-nitroethyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-2-methoxypropan-1-one.
| Compound Name | (2S)-1-[5-(2,5-difluorophenyl)-6'-fluoro-3'-(2-nitroethyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-2-methoxypropan-1-one |
|---|---|
| PubChem CID | 58274840 |
| Molecular Formula | C22H20F3N3O5S |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | (2S)-1-[5-(2,5-difluorophenyl)-6'-fluoro-3'-(2-nitroethyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydrochromene]-3-yl]-2-methoxypropan-1-one |
| SMILES | CO[C@@H](C)C(=O)N1N=C(c2cc(F)ccc2F)SC12c1cc(F)ccc1OCC2CC[N+](=O)[O-] |
| InChI | InChI=1S/C22H20F3N3O5S/c1-12(32-2)21(29)28-22(34-20(26-28)16-9-14(23)3-5-18(16)25)13(7-8-27(30)31)11-33-19-6-4-15(24)10-17(19)22/h3-6,9-10,12-13H,7-8,11H2,1-2H3/t12-,13?,22?/m0/s1 |
| InChIKey | VQZCGDRNUKSDFF-RKMNEVLWSA-N |
| XLogP | 3.90 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|