C18H15F2N3O3S — CID 124635365
(3S,4S)-5'-(2,5-difluorophenyl)-3-(2-nitroethyl)spiro[2,3-dihydrochromene-4,2'-3H-1,3,4-thiadiazole] (PubChem CID 124635365) has the molecular formula C18H15F2N3O3S and a molecular weight of 391.40 g/mol. Its IUPAC name is (3S,4S)-5'-(2,5-difluorophenyl)-3-(2-nitroethyl)spiro[2,3-dihydrochromene-4,2'-3H-1,3,4-thiadiazole].
| Compound Name | (3S,4S)-5'-(2,5-difluorophenyl)-3-(2-nitroethyl)spiro[2,3-dihydrochromene-4,2'-3H-1,3,4-thiadiazole] |
|---|---|
| PubChem CID | 124635365 |
| Molecular Formula | C18H15F2N3O3S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (3S,4S)-5'-(2,5-difluorophenyl)-3-(2-nitroethyl)spiro[2,3-dihydrochromene-4,2'-3H-1,3,4-thiadiazole] |
| SMILES | O=[N+]([O-])CC[C@H]1COc2ccccc2[C@]12NN=C(c1cc(F)ccc1F)S2 |
| InChI | InChI=1S/C18H15F2N3O3S/c19-12-5-6-15(20)13(9-12)17-21-22-18(27-17)11(7-8-23(24)25)10-26-16-4-2-1-3-14(16)18/h1-6,9,11,22H,7-8,10H2/t11-,18-/m0/s1 |
| InChIKey | ORMOGCQQYLHSFG-VOJFVSQTSA-N |
| XLogP | 3.49 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|