C22H23F3N4S — CID 143795190
2-[(3S,4S)-5'-(2,5-difluorophenyl)-7-fluoro-3'-prop-1-en-2-ylspiro[1,2,3,5-tetrahydrocyclohepta[b]pyridine-4,2'-1,3,4-thiadiazole]-3-yl]ethanamine (PubChem CID 143795190) has the molecular formula C22H23F3N4S and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[(3S,4S)-5'-(2,5-difluorophenyl)-7-fluoro-3'-prop-1-en-2-ylspiro[1,2,3,5-tetrahydrocyclohepta[b]pyridine-4,2'-1,3,4-thiadiazole]-3-yl]ethanamine.
| Compound Name | 2-[(3S,4S)-5'-(2,5-difluorophenyl)-7-fluoro-3'-prop-1-en-2-ylspiro[1,2,3,5-tetrahydrocyclohepta[b]pyridine-4,2'-1,3,4-thiadiazole]-3-yl]ethanamine |
|---|---|
| PubChem CID | 143795190 |
| Molecular Formula | C22H23F3N4S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[(3S,4S)-5'-(2,5-difluorophenyl)-7-fluoro-3'-prop-1-en-2-ylspiro[1,2,3,5-tetrahydrocyclohepta[b]pyridine-4,2'-1,3,4-thiadiazole]-3-yl]ethanamine |
| SMILES | C=C(C)N1N=C(c2cc(F)ccc2F)S[C@@]12C1=C(C=CC(F)=CC1)NC[C@@H]2CCN |
| InChI | InChI=1S/C22H23F3N4S/c1-13(2)29-22(30-21(28-29)17-11-16(24)4-7-19(17)25)14(9-10-26)12-27-20-8-5-15(23)3-6-18(20)22/h3-5,7-8,11,14,27H,1,6,9-10,12,26H2,2H3/t14-,22-/m0/s1 |
| InChIKey | RGVCTCBHZQUFLL-FPTDNZKUSA-N |
| XLogP | 4.54 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |