C20H22F2N4OS — CID 153141076
1-[3'-(2-aminoethyl)-5-(3,6-difluorocyclohexa-1,5-dien-1-yl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone (PubChem CID 153141076) has the molecular formula C20H22F2N4OS and a molecular weight of 404.49 g/mol. Its IUPAC name is 1-[3'-(2-aminoethyl)-5-(3,6-difluorocyclohexa-1,5-dien-1-yl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone.
| Compound Name | 1-[3'-(2-aminoethyl)-5-(3,6-difluorocyclohexa-1,5-dien-1-yl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone |
|---|---|
| PubChem CID | 153141076 |
| Molecular Formula | C20H22F2N4OS |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 1-[3'-(2-aminoethyl)-5-(3,6-difluorocyclohexa-1,5-dien-1-yl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(C2=CC(F)CC=C2F)SC12c1ccccc1NCC2CCN |
| InChI | InChI=1S/C20H22F2N4OS/c1-12(27)26-20(28-19(25-26)15-10-14(21)6-7-17(15)22)13(8-9-23)11-24-18-5-3-2-4-16(18)20/h2-5,7,10,13-14,24H,6,8-9,11,23H2,1H3 |
| InChIKey | VYQFFYNCYXNFHW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |