C21H24F2N4OS — CID 143891393
1-[3'-(2-aminoethyl)-8'-fluoro-5-(4-fluorohepta-2,3,6-trienyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone (PubChem CID 143891393) has the molecular formula C21H24F2N4OS and a molecular weight of 418.51 g/mol. Its IUPAC name is 1-[3'-(2-aminoethyl)-8'-fluoro-5-(4-fluorohepta-2,3,6-trienyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone.
| Compound Name | 1-[3'-(2-aminoethyl)-8'-fluoro-5-(4-fluorohepta-2,3,6-trienyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone |
|---|---|
| PubChem CID | 143891393 |
| Molecular Formula | C21H24F2N4OS |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1-[3'-(2-aminoethyl)-8'-fluoro-5-(4-fluorohepta-2,3,6-trienyl)spiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-quinoline]-3-yl]ethanone |
| SMILES | C=CCC(F)=C=CCC1=NN(C(C)=O)C2(S1)c1cccc(F)c1NCC2CCN |
| InChI | InChI=1S/C21H24F2N4OS/c1-3-6-16(22)7-4-10-19-26-27(14(2)28)21(29-19)15(11-12-24)13-25-20-17(21)8-5-9-18(20)23/h3-5,8-9,15,25H,1,6,10-13,24H2,2H3 |
| InChIKey | ZEEZYOYZJMMABQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|