C37H46ClN5O5 — CID 143795642
1-acetyl-N-(3-chloro-4-methylphenyl)-N-[3-[4-[ethyl-[2-(4-nitronaphthalen-1-yl)acetyl]amino]piperidin-1-yl]propyl]piperidine-4-carboxamide (PubChem CID 143795642) has the molecular formula C37H46ClN5O5 and a molecular weight of 676.26 g/mol. Its IUPAC name is 1-acetyl-N-(3-chloro-4-methylphenyl)-N-[3-[4-[ethyl-[2-(4-nitronaphthalen-1-yl)acetyl]amino]piperidin-1-yl]propyl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-(3-chloro-4-methylphenyl)-N-[3-[4-[ethyl-[2-(4-nitronaphthalen-1-yl)acetyl]amino]piperidin-1-yl]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 143795642 |
| Molecular Formula | C37H46ClN5O5 |
| Molecular Weight | 676.26 g/mol |
| Exact Mass | 675.32 |
| IUPAC Name | 1-acetyl-N-(3-chloro-4-methylphenyl)-N-[3-[4-[ethyl-[2-(4-nitronaphthalen-1-yl)acetyl]amino]piperidin-1-yl]propyl]piperidine-4-carboxamide |
| SMILES | CCN(C(=O)Cc1ccc([N+](=O)[O-])c2ccccc12)C1CCN(CCCN(C(=O)C2CCN(C(C)=O)CC2)c2ccc(C)c(Cl)c2)CC1 |
| InChI | InChI=1S/C37H46ClN5O5/c1-4-41(36(45)24-29-11-13-35(43(47)48)33-9-6-5-8-32(29)33)30-16-20-39(21-17-30)18-7-19-42(31-12-10-26(2)34(38)25-31)37(46)28-14-22-40(23-15-28)27(3)44/h5-6,8-13,25,28,30H,4,7,14-24H2,1-3H3 |
| InChIKey | GBUCPJOWUAPWLW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 107.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.26 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|