C34H45ClN4O3 — CID 91021281
1-acetyl-N-(3-chloro-4-methylphenyl)-N-[3-[5-(2,4,6-trimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]piperidine-4-carboxamide (PubChem CID 91021281) has the molecular formula C34H45ClN4O3 and a molecular weight of 593.21 g/mol. Its IUPAC name is 1-acetyl-N-(3-chloro-4-methylphenyl)-N-[3-[5-(2,4,6-trimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-(3-chloro-4-methylphenyl)-N-[3-[5-(2,4,6-trimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 91021281 |
| Molecular Formula | C34H45ClN4O3 |
| Molecular Weight | 593.21 g/mol |
| Exact Mass | 592.32 |
| IUPAC Name | 1-acetyl-N-(3-chloro-4-methylphenyl)-N-[3-[5-(2,4,6-trimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)N(CCCN2CC3CN(C(=O)c4c(C)cc(C)cc4C)CC3C2)c2ccc(C)c(Cl)c2)CC1 |
| InChI | InChI=1S/C34H45ClN4O3/c1-22-15-24(3)32(25(4)16-22)34(42)38-20-28-18-36(19-29(28)21-38)11-6-12-39(30-8-7-23(2)31(35)17-30)33(41)27-9-13-37(14-10-27)26(5)40/h7-8,15-17,27-29H,6,9-14,18-21H2,1-5H3 |
| InChIKey | OAAHIFIYWWILIY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.21 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |