C32H40BrClN4O4 — CID 91548059
1-acetyl-N-[3-[5-(2-bromo-5-methoxybenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-N-(3-chloro-4-methylphenyl)piperidine-4-carboxamide (PubChem CID 91548059) has the molecular formula C32H40BrClN4O4 and a molecular weight of 660.05 g/mol. Its IUPAC name is 1-acetyl-N-[3-[5-(2-bromo-5-methoxybenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-N-(3-chloro-4-methylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-[3-[5-(2-bromo-5-methoxybenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-N-(3-chloro-4-methylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 91548059 |
| Molecular Formula | C32H40BrClN4O4 |
| Molecular Weight | 660.05 g/mol |
| Exact Mass | 658.19 |
| IUPAC Name | 1-acetyl-N-[3-[5-(2-bromo-5-methoxybenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]-N-(3-chloro-4-methylphenyl)piperidine-4-carboxamide |
| SMILES | COc1ccc(Br)c(C(=O)N2CC3CN(CCCN(C(=O)C4CCN(C(C)=O)CC4)c4ccc(C)c(Cl)c4)CC3C2)c1 |
| InChI | InChI=1S/C32H40BrClN4O4/c1-21-5-6-26(15-30(21)34)38(31(40)23-9-13-36(14-10-23)22(2)39)12-4-11-35-17-24-19-37(20-25(24)18-35)32(41)28-16-27(42-3)7-8-29(28)33/h5-8,15-16,23-25H,4,9-14,17-20H2,1-3H3 |
| InChIKey | MVOYKRWZSMMPTE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.05 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |