About methoxyethane;3-methylpyridine-4-carbaldehyde
methoxyethane;3-methylpyridine-4-carbaldehyde (PubChem CID 143796958) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is methoxyethane;3-methylpyridine-4-carbaldehyde.
Molecular Properties
| Compound Name | methoxyethane;3-methylpyridine-4-carbaldehyde |
| PubChem CID | 143796958 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | methoxyethane;3-methylpyridine-4-carbaldehyde |
| SMILES | CCOC.Cc1cnccc1C=O |
| InChI | InChI=1S/C7H7NO.C3H8O/c1-6-4-8-3-2-7(6)5-9;1-3-4-2/h2-5H,1H3;3H2,1-2H3 |
| InChIKey | AHXAGCKDBBNOSD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methoxyethane;3-methylpyridine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxyethane;3-methylpyridine-4-carbaldehyde?
The IUPAC name of methoxyethane;3-methylpyridine-4-carbaldehyde (CID 143796958) is methoxyethane;3-methylpyridine-4-carbaldehyde.
What is the SMILES notation for methoxyethane;3-methylpyridine-4-carbaldehyde?
The canonical SMILES for methoxyethane;3-methylpyridine-4-carbaldehyde is CCOC.Cc1cnccc1C=O.
What is the InChIKey of methoxyethane;3-methylpyridine-4-carbaldehyde?
The InChIKey is AHXAGCKDBBNOSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C3H8O/c1-6-4-8-3-2-7(6)5-9;1-3-4-2/h2-5H,1H3;3H2,1-2H3.
What are the key properties of methoxyethane;3-methylpyridine-4-carbaldehyde?
methoxyethane;3-methylpyridine-4-carbaldehyde has a molecular weight of 181.23 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxyethane;3-methylpyridine-4-carbaldehyde is sourced from PubChem (CID 143796958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).