About methyl formate;3-methylpyridin-4-amine
methyl formate;3-methylpyridin-4-amine (PubChem CID 160726119) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is methyl formate;3-methylpyridin-4-amine.
Molecular Properties
| Compound Name | methyl formate;3-methylpyridin-4-amine |
| PubChem CID | 160726119 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | methyl formate;3-methylpyridin-4-amine |
| SMILES | COC=O.Cc1cnccc1N |
| InChI | InChI=1S/C6H8N2.C2H4O2/c1-5-4-8-3-2-6(5)7;1-4-2-3/h2-4H,1H3,(H2,7,8);2H,1H3 |
| InChIKey | RTSRLNWKDZTBDU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl formate;3-methylpyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl formate;3-methylpyridin-4-amine?
The IUPAC name of methyl formate;3-methylpyridin-4-amine (CID 160726119) is methyl formate;3-methylpyridin-4-amine.
What is the SMILES notation for methyl formate;3-methylpyridin-4-amine?
The canonical SMILES for methyl formate;3-methylpyridin-4-amine is COC=O.Cc1cnccc1N.
What is the InChIKey of methyl formate;3-methylpyridin-4-amine?
The InChIKey is RTSRLNWKDZTBDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.C2H4O2/c1-5-4-8-3-2-6(5)7;1-4-2-3/h2-4H,1H3,(H2,7,8);2H,1H3.
What are the key properties of methyl formate;3-methylpyridin-4-amine?
methyl formate;3-methylpyridin-4-amine has a molecular weight of 168.20 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl formate;3-methylpyridin-4-amine is sourced from PubChem (CID 160726119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).