About 1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde
1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde (PubChem CID 143796965) has the molecular formula C16H26N2O
and a molecular weight of 262.40 g/mol. Its IUPAC name is 1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde.
Molecular Properties
| Compound Name | 1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde |
| PubChem CID | 143796965 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde |
| SMILES | CCN1CCCC1CNC.Cc1ccccc1C=O |
| InChI | InChI=1S/C8H18N2.C8H8O/c1-3-10-6-4-5-8(10)7-9-2;1-7-4-2-3-5-8(7)6-9/h8-9H,3-7H2,1-2H3;2-6H,1H3 |
| InChIKey | QCBLBFDUNIHURW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde?
The IUPAC name of 1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde (CID 143796965) is 1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde.
What is the SMILES notation for 1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde?
The canonical SMILES for 1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde is CCN1CCCC1CNC.Cc1ccccc1C=O.
What is the InChIKey of 1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde?
The InChIKey is QCBLBFDUNIHURW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2.C8H8O/c1-3-10-6-4-5-8(10)7-9-2;1-7-4-2-3-5-8(7)6-9/h8-9H,3-7H2,1-2H3;2-6H,1H3.
What are the key properties of 1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde?
1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde has a molecular weight of 262.40 g/mol, XLogP of 2.50, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethylpyrrolidin-2-yl)-N-methylmethanamine;2-methylbenzaldehyde is sourced from PubChem (CID 143796965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).