C8H13NOS — CID 143797025
2,4-dimethylthiophene-3-carbaldehyde;methanamine (PubChem CID 143797025) has the molecular formula C8H13NOS and a molecular weight of 171.26 g/mol. Its IUPAC name is 2,4-dimethylthiophene-3-carbaldehyde;methanamine.
| Compound Name | 2,4-dimethylthiophene-3-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 143797025 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 2,4-dimethylthiophene-3-carbaldehyde;methanamine |
| SMILES | CN.Cc1csc(C)c1C=O |
| InChI | InChI=1S/C7H8OS.CH5N/c1-5-4-9-6(2)7(5)3-8;1-2/h3-4H,1-2H3;2H2,1H3 |
| InChIKey | UILBODWCZQWWRZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|