C7H14ClN — CID 143798119
N,2-dimethylpent-4-en-1-imine;hydrochloride (PubChem CID 143798119) has the molecular formula C7H14ClN and a molecular weight of 147.65 g/mol. Its IUPAC name is N,2-dimethylpent-4-en-1-imine;hydrochloride.
| Compound Name | N,2-dimethylpent-4-en-1-imine;hydrochloride |
|---|---|
| PubChem CID | 143798119 |
| Molecular Formula | C7H14ClN |
| Molecular Weight | 147.65 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | N,2-dimethylpent-4-en-1-imine;hydrochloride |
| SMILES | C=CCC(C)/C=N/C.Cl |
| InChI | InChI=1S/C7H13N.ClH/c1-4-5-7(2)6-8-3;/h4,6-7H,1,5H2,2-3H3;1H/b8-6+; |
| InChIKey | YQUTWBNOZVKNHK-WVLIHFOGSA-N |
| XLogP | 2.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.65 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|