C7H11N — CID 59584680
(3R,4R)-3,4-dimethyl-3,4-dihydropyridine (PubChem CID 59584680) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is (3R,4R)-3,4-dimethyl-3,4-dihydropyridine.
| Compound Name | (3R,4R)-3,4-dimethyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 59584680 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | (3R,4R)-3,4-dimethyl-3,4-dihydropyridine |
| SMILES | C[C@@H]1C=CN=C[C@@H]1C |
| InChI | InChI=1S/C7H11N/c1-6-3-4-8-5-7(6)2/h3-7H,1-2H3/t6-,7+/m1/s1 |
| InChIKey | NLCSWVUCLFYVKA-RQJHMYQMSA-N |
| XLogP | 1.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |