C11H18 — CID 143799857
cis-(2R,3S)-2-ethynyl-1,1,3-trimethylcyclohexane (PubChem CID 143799857) has the molecular formula C11H18 and a molecular weight of 150.27 g/mol. Its IUPAC name is cis-(2R,3S)-2-ethynyl-1,1,3-trimethylcyclohexane.
| Compound Name | cis-(2R,3S)-2-ethynyl-1,1,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 143799857 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | cis-(2R,3S)-2-ethynyl-1,1,3-trimethylcyclohexane |
| SMILES | C#C[C@@H]1[C@@H](C)CCCC1(C)C |
| InChI | InChI=1S/C11H18/c1-5-10-9(2)7-6-8-11(10,3)4/h1,9-10H,6-8H2,2-4H3/t9-,10+/m0/s1 |
| InChIKey | QJCRZXISXFWFMV-VHSXEESVSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|