C19H39N7O4 — CID 143800393
3-[2,2-bis[(3-amino-3-iminopropoxy)methyl]-3-(2-cyanoethoxy)propoxy]propanimidamide;ethane (PubChem CID 143800393) has the molecular formula C19H39N7O4 and a molecular weight of 429.57 g/mol. Its IUPAC name is 3-[2,2-bis[(3-amino-3-iminopropoxy)methyl]-3-(2-cyanoethoxy)propoxy]propanimidamide;ethane.
| Compound Name | 3-[2,2-bis[(3-amino-3-iminopropoxy)methyl]-3-(2-cyanoethoxy)propoxy]propanimidamide;ethane |
|---|---|
| PubChem CID | 143800393 |
| Molecular Formula | C19H39N7O4 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | 3-[2,2-bis[(3-amino-3-iminopropoxy)methyl]-3-(2-cyanoethoxy)propoxy]propanimidamide;ethane |
| SMILES | CC.[H]/N=C(\N)CCOCC(COCCC#N)(COCC/C(N)=N/[H])COCC/C(N)=N/[H] |
| InChI | InChI=1S/C17H33N7O4.C2H6/c18-5-1-6-25-10-17(11-26-7-2-14(19)20,12-27-8-3-15(21)22)13-28-9-4-16(23)24;1-2/h1-4,6-13H2,(H3,19,20)(H3,21,22)(H3,23,24);1-2H3 |
| InChIKey | LYOCLWJIRJYDIH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 210.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|