C12H23N3 — CID 143800495
2-cyclohexa-1,5-dien-1-yl-1-methylpiperazine;methanamine (PubChem CID 143800495) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-1-methylpiperazine;methanamine.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-1-methylpiperazine;methanamine |
|---|---|
| PubChem CID | 143800495 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-1-methylpiperazine;methanamine |
| SMILES | CN.CN1CCNCC1C1=CCCC=C1 |
| InChI | InChI=1S/C11H18N2.CH5N/c1-13-8-7-12-9-11(13)10-5-3-2-4-6-10;1-2/h3,5-6,11-12H,2,4,7-9H2,1H3;2H2,1H3 |
| InChIKey | QYCVVXDGIPDJQD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |