C11H18N2 — CID 143800496
2-cyclohexa-1,5-dien-1-yl-1-methylpiperazine (PubChem CID 143800496) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-1-methylpiperazine.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-1-methylpiperazine |
|---|---|
| PubChem CID | 143800496 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-1-methylpiperazine |
| SMILES | CN1CCNCC1C1=CCCC=C1 |
| InChI | InChI=1S/C11H18N2/c1-13-8-7-12-9-11(13)10-5-3-2-4-6-10/h3,5-6,11-12H,2,4,7-9H2,1H3 |
| InChIKey | ZBAAJRJJVOMHOJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |