C51H48N2O — CID 143802769
ethane;6-[4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-(4-phenylcyclohexa-1,3-dien-1-yl)anilino]-3-methylphenyl]-9-phenylcarbazol-3-ol (PubChem CID 143802769) has the molecular formula C51H48N2O and a molecular weight of 704.96 g/mol. Its IUPAC name is ethane;6-[4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-(4-phenylcyclohexa-1,3-dien-1-yl)anilino]-3-methylphenyl]-9-phenylcarbazol-3-ol.
| Compound Name | ethane;6-[4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-(4-phenylcyclohexa-1,3-dien-1-yl)anilino]-3-methylphenyl]-9-phenylcarbazol-3-ol |
|---|---|
| PubChem CID | 143802769 |
| Molecular Formula | C51H48N2O |
| Molecular Weight | 704.96 g/mol |
| Exact Mass | 704.38 |
| IUPAC Name | ethane;6-[4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-(4-phenylcyclohexa-1,3-dien-1-yl)anilino]-3-methylphenyl]-9-phenylcarbazol-3-ol |
| SMILES | C/C=C\C(=C/C)c1ccc(N(C2=CC=C(c3ccccc3)CC2)c2ccc(-c3ccc4c(c3)c3cc(O)ccc3n4-c3ccccc3)cc2C)cc1.CC |
| InChI | InChI=1S/C49H42N2O.C2H6/c1-4-12-35(5-2)37-17-23-42(24-18-37)50(43-25-19-38(20-26-43)36-13-8-6-9-14-36)47-28-21-39(31-34(47)3)40-22-29-48-45(32-40)46-33-44(52)27-30-49(46)51(48)41-15-10-7-11-16-41;1-2/h4-19,21-25,27-33,52H,20,26H2,1-3H3;1-2H3/b12-4-,35-5+; |
| InChIKey | LAOUUADYQHNNNQ-JGRPOJQISA-N |
| XLogP | 14.37 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.96 |
| LogP ≤ 5 | 14.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|