C21H29N7S — CID 143803577
N-ethyl-5-piperidin-3-yl-3-(1,3-thiazol-5-yl)pyrazolo[1,5-a]pyrimidin-7-amine;N-methylbut-3-en-2-imine (PubChem CID 143803577) has the molecular formula C21H29N7S and a molecular weight of 411.58 g/mol. Its IUPAC name is N-ethyl-5-piperidin-3-yl-3-(1,3-thiazol-5-yl)pyrazolo[1,5-a]pyrimidin-7-amine;N-methylbut-3-en-2-imine.
| Compound Name | N-ethyl-5-piperidin-3-yl-3-(1,3-thiazol-5-yl)pyrazolo[1,5-a]pyrimidin-7-amine;N-methylbut-3-en-2-imine |
|---|---|
| PubChem CID | 143803577 |
| Molecular Formula | C21H29N7S |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-ethyl-5-piperidin-3-yl-3-(1,3-thiazol-5-yl)pyrazolo[1,5-a]pyrimidin-7-amine;N-methylbut-3-en-2-imine |
| SMILES | C=C/C(C)=N/C.CCNc1cc(C2CCCNC2)nc2c(-c3cncs3)cnn12 |
| InChI | InChI=1S/C16H20N6S.C5H9N/c1-2-19-15-6-13(11-4-3-5-17-7-11)21-16-12(8-20-22(15)16)14-9-18-10-23-14;1-4-5(2)6-3/h6,8-11,17,19H,2-5,7H2,1H3;4H,1H2,2-3H3/b;6-5+ |
| InChIKey | YMIPXJIHMATVKJ-MXDQRGINSA-N |
| XLogP | 4.01 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|