C22H42BrN7 — CID 143803583
(4E)-4-[2-[(E)-1-amino-2-bromoethenyl]pyrazol-3-yl]imino-N-butylbutan-1-amine;ethane;4-methyl-1,4-dihydropyridazine (PubChem CID 143803583) has the molecular formula C22H42BrN7 and a molecular weight of 484.53 g/mol. Its IUPAC name is (4E)-4-[2-[(E)-1-amino-2-bromoethenyl]pyrazol-3-yl]imino-N-butylbutan-1-amine;ethane;4-methyl-1,4-dihydropyridazine.
| Compound Name | (4E)-4-[2-[(E)-1-amino-2-bromoethenyl]pyrazol-3-yl]imino-N-butylbutan-1-amine;ethane;4-methyl-1,4-dihydropyridazine |
|---|---|
| PubChem CID | 143803583 |
| Molecular Formula | C22H42BrN7 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | (4E)-4-[2-[(E)-1-amino-2-bromoethenyl]pyrazol-3-yl]imino-N-butylbutan-1-amine;ethane;4-methyl-1,4-dihydropyridazine |
| SMILES | CC.CC.CC1C=CNN=C1.CCCCNCCC/C=N/c1ccnn1/C(N)=C/Br |
| InChI | InChI=1S/C13H22BrN5.C5H8N2.2C2H6/c1-2-3-7-16-8-4-5-9-17-13-6-10-18-19(13)12(15)11-14;1-5-2-3-6-7-4-5;2*1-2/h6,9-11,16H,2-5,7-8,15H2,1H3;2-6H,1H3;2*1-2H3/b12-11+,17-9+;;; |
| InChIKey | XITCSTKNYPJHRK-KLHCYFEZSA-N |
| XLogP | 5.64 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|