C21H18N6OS — CID 143804870
5-[2-(4-imidazol-1-ylphenyl)-3H-benzimidazol-5-yl]-3,6-dimethyl-6H-1,3,4-thiadiazin-2-one (PubChem CID 143804870) has the molecular formula C21H18N6OS and a molecular weight of 402.48 g/mol. Its IUPAC name is 5-[2-(4-imidazol-1-ylphenyl)-3H-benzimidazol-5-yl]-3,6-dimethyl-6H-1,3,4-thiadiazin-2-one.
| Compound Name | 5-[2-(4-imidazol-1-ylphenyl)-3H-benzimidazol-5-yl]-3,6-dimethyl-6H-1,3,4-thiadiazin-2-one |
|---|---|
| PubChem CID | 143804870 |
| Molecular Formula | C21H18N6OS |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 5-[2-(4-imidazol-1-ylphenyl)-3H-benzimidazol-5-yl]-3,6-dimethyl-6H-1,3,4-thiadiazin-2-one |
| SMILES | CC1SC(=O)N(C)N=C1c1ccc2nc(-c3ccc(-n4ccnc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C21H18N6OS/c1-13-19(25-26(2)21(28)29-13)15-5-8-17-18(11-15)24-20(23-17)14-3-6-16(7-4-14)27-10-9-22-12-27/h3-13H,1-2H3,(H,23,24) |
| InChIKey | PLSHPKFPJNYMIK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|