C28H28N8O3S2 — CID 157387380
5-(3,4-diaminophenyl)-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one;5-[2-(3-methoxyphenyl)-3H-benzimidazol-5-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one (PubChem CID 157387380) has the molecular formula C28H28N8O3S2 and a molecular weight of 588.72 g/mol. Its IUPAC name is 5-(3,4-diaminophenyl)-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one;5-[2-(3-methoxyphenyl)-3H-benzimidazol-5-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one.
| Compound Name | 5-(3,4-diaminophenyl)-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one;5-[2-(3-methoxyphenyl)-3H-benzimidazol-5-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one |
|---|---|
| PubChem CID | 157387380 |
| Molecular Formula | C28H28N8O3S2 |
| Molecular Weight | 588.72 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | 5-(3,4-diaminophenyl)-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one;5-[2-(3-methoxyphenyl)-3H-benzimidazol-5-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one |
| SMILES | CC1SC(=O)NN=C1c1ccc(N)c(N)c1.COc1cccc(-c2nc3ccc(C4=NNC(=O)SC4C)cc3[nH]2)c1 |
| InChI | InChI=1S/C18H16N4O2S.C10H12N4OS/c1-10-16(21-22-18(23)25-10)11-6-7-14-15(9-11)20-17(19-14)12-4-3-5-13(8-12)24-2;1-5-9(13-14-10(15)16-5)6-2-3-7(11)8(12)4-6/h3-10H,1-2H3,(H,19,20)(H,22,23);2-5H,11-12H2,1H3,(H,14,15) |
| InChIKey | BLPANGYUZXJQER-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 172.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.72 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|