C21H22N5O3S+ — CID 143804872
2-[5-[2-(3-methoxyphenyl)-1-methyl-3H-benzimidazol-1-ium-5-yl]-6-methyl-2-oxo-6H-1,3,4-thiadiazin-3-yl]acetamide (PubChem CID 143804872) has the molecular formula C21H22N5O3S+ and a molecular weight of 424.51 g/mol. Its IUPAC name is 2-[5-[2-(3-methoxyphenyl)-1-methyl-3H-benzimidazol-1-ium-5-yl]-6-methyl-2-oxo-6H-1,3,4-thiadiazin-3-yl]acetamide.
| Compound Name | 2-[5-[2-(3-methoxyphenyl)-1-methyl-3H-benzimidazol-1-ium-5-yl]-6-methyl-2-oxo-6H-1,3,4-thiadiazin-3-yl]acetamide |
|---|---|
| PubChem CID | 143804872 |
| Molecular Formula | C21H22N5O3S+ |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-[5-[2-(3-methoxyphenyl)-1-methyl-3H-benzimidazol-1-ium-5-yl]-6-methyl-2-oxo-6H-1,3,4-thiadiazin-3-yl]acetamide |
| SMILES | COc1cccc(-c2[nH]c3cc(C4=NN(CC(N)=O)C(=O)SC4C)ccc3[n+]2C)c1 |
| InChI | InChI=1S/C21H21N5O3S/c1-12-19(24-26(11-18(22)27)21(28)30-12)13-7-8-17-16(10-13)23-20(25(17)2)14-5-4-6-15(9-14)29-3/h4-10,12H,11H2,1-3H3,(H2,22,27)/p+1 |
| InChIKey | SRHWHMWMUVSTSK-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 104.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|