C38H37NO2 — CID 143804972
[2-[3-hydroxy-2-[[4-[3-(4-methyl-2-phenyl-3H-pyrrol-5-yl)propyl]phenyl]methyl]but-3-enyl]phenyl]-phenylmethanone (PubChem CID 143804972) has the molecular formula C38H37NO2 and a molecular weight of 539.72 g/mol. Its IUPAC name is [2-[3-hydroxy-2-[[4-[3-(4-methyl-2-phenyl-3H-pyrrol-5-yl)propyl]phenyl]methyl]but-3-enyl]phenyl]-phenylmethanone.
| Compound Name | [2-[3-hydroxy-2-[[4-[3-(4-methyl-2-phenyl-3H-pyrrol-5-yl)propyl]phenyl]methyl]but-3-enyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 143804972 |
| Molecular Formula | C38H37NO2 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | [2-[3-hydroxy-2-[[4-[3-(4-methyl-2-phenyl-3H-pyrrol-5-yl)propyl]phenyl]methyl]but-3-enyl]phenyl]-phenylmethanone |
| SMILES | C=C(O)C(Cc1ccc(CCCC2=C(C)CC(c3ccccc3)=N2)cc1)Cc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C38H37NO2/c1-27-24-37(31-13-5-3-6-14-31)39-36(27)19-11-12-29-20-22-30(23-21-29)25-34(28(2)40)26-33-17-9-10-18-35(33)38(41)32-15-7-4-8-16-32/h3-10,13-18,20-23,34,40H,2,11-12,19,24-26H2,1H3 |
| InChIKey | OZBUGGAGQWSGEM-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|