C34H34N2O2 — CID 91499870
2-(1-hydroxypropan-2-yl)-8-methyl-3,4-bis(2-phenylethylimino)phenanthren-1-one (PubChem CID 91499870) has the molecular formula C34H34N2O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 2-(1-hydroxypropan-2-yl)-8-methyl-3,4-bis(2-phenylethylimino)phenanthren-1-one.
| Compound Name | 2-(1-hydroxypropan-2-yl)-8-methyl-3,4-bis(2-phenylethylimino)phenanthren-1-one |
|---|---|
| PubChem CID | 91499870 |
| Molecular Formula | C34H34N2O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 2-(1-hydroxypropan-2-yl)-8-methyl-3,4-bis(2-phenylethylimino)phenanthren-1-one |
| SMILES | Cc1cccc2c3c(ccc12)C(=O)C(C(C)CO)C(=N\CCc1ccccc1)/C3=N\CCc1ccccc1 |
| InChI | InChI=1S/C34H34N2O2/c1-23-10-9-15-28-27(23)16-17-29-31(28)33(36-21-19-26-13-7-4-8-14-26)32(30(34(29)38)24(2)22-37)35-20-18-25-11-5-3-6-12-25/h3-17,24,30,37H,18-22H2,1-2H3/b35-32+,36-33- |
| InChIKey | DOYQHONCFZPLLE-LRMUHLAZSA-N |
| XLogP | 6.30 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|