C18H17NO3 — CID 91390035
2-(1-hydroxypropan-2-yl)-1-imino-8-methylphenanthrene-3,4-dione (PubChem CID 91390035) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-(1-hydroxypropan-2-yl)-1-imino-8-methylphenanthrene-3,4-dione.
| Compound Name | 2-(1-hydroxypropan-2-yl)-1-imino-8-methylphenanthrene-3,4-dione |
|---|---|
| PubChem CID | 91390035 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-(1-hydroxypropan-2-yl)-1-imino-8-methylphenanthrene-3,4-dione |
| SMILES | [H]/N=C1\c2ccc3c(C)cccc3c2C(=O)C(=O)C1C(C)CO |
| InChI | InChI=1S/C18H17NO3/c1-9-4-3-5-12-11(9)6-7-13-15(12)18(22)17(21)14(16(13)19)10(2)8-20/h3-7,10,14,19-20H,8H2,1-2H3/b19-16+ |
| InChIKey | GGMAQPTUMOIZQE-KNTRCKAVSA-N |
| XLogP | 2.53 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|